C17H35NO4 — CID 101343818
1-[1,2-dihydroxypropyl(undec-10-enyl)amino]propane-1,2-diol (PubChem CID 101343818) has the molecular formula C17H35NO4 and a molecular weight of 317.47 g/mol. Its IUPAC name is 1-[1,2-dihydroxypropyl(undec-10-enyl)amino]propane-1,2-diol.
| Compound Name | 1-[1,2-dihydroxypropyl(undec-10-enyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 101343818 |
| Molecular Formula | C17H35NO4 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 1-[1,2-dihydroxypropyl(undec-10-enyl)amino]propane-1,2-diol |
| SMILES | C=CCCCCCCCCCN(C(O)C(C)O)C(O)C(C)O |
| InChI | InChI=1S/C17H35NO4/c1-4-5-6-7-8-9-10-11-12-13-18(16(21)14(2)19)17(22)15(3)20/h4,14-17,19-22H,1,5-13H2,2-3H3 |
| InChIKey | LSZLDJOUXHPMPO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|