C30H54CaN4O8 — CID 101286380
calcium;2-[3-hydroxypropyl-[(oct-7-enoylamino)methyl]amino]propanoic acid;2-[3-hydroxypropyl-[(1-oxidooct-7-enylideneamino)methyl]amino]propanoate (PubChem CID 101286380) has the molecular formula C30H54CaN4O8 and a molecular weight of 638.86 g/mol. Its IUPAC name is calcium;2-[3-hydroxypropyl-[(oct-7-enoylamino)methyl]amino]propanoic acid;2-[3-hydroxypropyl-[(1-oxidooct-7-enylideneamino)methyl]amino]propanoate.
| Compound Name | calcium;2-[3-hydroxypropyl-[(oct-7-enoylamino)methyl]amino]propanoic acid;2-[3-hydroxypropyl-[(1-oxidooct-7-enylideneamino)methyl]amino]propanoate |
|---|---|
| PubChem CID | 101286380 |
| Molecular Formula | C30H54CaN4O8 |
| Molecular Weight | 638.86 g/mol |
| Exact Mass | 638.36 |
| IUPAC Name | calcium;2-[3-hydroxypropyl-[(oct-7-enoylamino)methyl]amino]propanoic acid;2-[3-hydroxypropyl-[(1-oxidooct-7-enylideneamino)methyl]amino]propanoate |
| SMILES | C=CCCCCCC(=O)NCN(CCCO)C(C)C(=O)O.C=CCCCCCC([O-])=NCN(CCCO)C(C)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C15H28N2O4.Ca/c2*1-3-4-5-6-7-9-14(19)16-12-17(10-8-11-18)13(2)15(20)21;/h2*3,13,18H,1,4-12H2,2H3,(H,16,19)(H,20,21);/q;;+2/p-2 |
| InChIKey | JOAOWOMNYBIGIO-UHFFFAOYSA-L |
| XLogP | 0.64 |
| TPSA | 188.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.86 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|