C14H25N2NaO4 — CID 101286181
sodium N-[[carboxymethyl(3-hydroxypropyl)amino]methyl]oct-7-enimidate (PubChem CID 101286181) has the molecular formula C14H25N2NaO4 and a molecular weight of 308.35 g/mol. Its IUPAC name is sodium N-[[carboxymethyl(3-hydroxypropyl)amino]methyl]oct-7-enimidate.
| Compound Name | sodium N-[[carboxymethyl(3-hydroxypropyl)amino]methyl]oct-7-enimidate |
|---|---|
| PubChem CID | 101286181 |
| Molecular Formula | C14H25N2NaO4 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | sodium N-[[carboxymethyl(3-hydroxypropyl)amino]methyl]oct-7-enimidate |
| SMILES | C=CCCCCCC([O-])=NCN(CCCO)CC(=O)O.[Na+] |
| InChI | InChI=1S/C14H26N2O4.Na/c1-2-3-4-5-6-8-13(18)15-12-16(9-7-10-17)11-14(19)20;/h2,17H,1,3-12H2,(H,15,18)(H,19,20);/q;+1/p-1 |
| InChIKey | MAWMJYLOXNSPQN-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|