C15H29LiN2O4 — CID 101286103
lithium N-[2-[carboxymethyl(3-hydroxypropyl)amino]ethyl]octanimidate (PubChem CID 101286103) has the molecular formula C15H29LiN2O4 and a molecular weight of 308.35 g/mol. Its IUPAC name is lithium N-[2-[carboxymethyl(3-hydroxypropyl)amino]ethyl]octanimidate.
| Compound Name | lithium N-[2-[carboxymethyl(3-hydroxypropyl)amino]ethyl]octanimidate |
|---|---|
| PubChem CID | 101286103 |
| Molecular Formula | C15H29LiN2O4 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | lithium N-[2-[carboxymethyl(3-hydroxypropyl)amino]ethyl]octanimidate |
| SMILES | CCCCCCC/C([O-])=N/CCN(CCCO)CC(=O)O.[Li+] |
| InChI | InChI=1S/C15H30N2O4.Li/c1-2-3-4-5-6-8-14(19)16-9-11-17(10-7-12-18)13-15(20)21;/h18H,2-13H2,1H3,(H,16,19)(H,20,21);/q;+1/p-1 |
| InChIKey | ALYALCCUNZLMFC-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|