C24H42N5O8-3 — CID 102397063
2-[bis[2-[carboxymethyl-(2-oxido-2-pentyliminoethyl)amino]ethyl]amino]acetate (PubChem CID 102397063) has the molecular formula C24H42N5O8-3 and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-(2-oxido-2-pentyliminoethyl)amino]ethyl]amino]acetate.
| Compound Name | 2-[bis[2-[carboxymethyl-(2-oxido-2-pentyliminoethyl)amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 102397063 |
| Molecular Formula | C24H42N5O8-3 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-(2-oxido-2-pentyliminoethyl)amino]ethyl]amino]acetate |
| SMILES | CCCCC/N=C(\[O-])CN(CCN(CCN(CC(=O)O)C/C([O-])=N/CCCCC)CC(=O)[O-])CC(=O)O |
| InChI | InChI=1S/C24H45N5O8/c1-3-5-7-9-25-20(30)15-28(18-23(34)35)13-11-27(17-22(32)33)12-14-29(19-24(36)37)16-21(31)26-10-8-6-4-2/h3-19H2,1-2H3,(H,25,30)(H,26,31)(H,32,33)(H,34,35)(H,36,37)/p-3 |
| InChIKey | IXMBBBDJPHSMAB-UHFFFAOYSA-K |
| XLogP | -2.29 |
| TPSA | 195.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|