C17H33N2NaO4 — CID 101286143
sodium N-[2-[2-carboxyethyl(4-hydroxybutyl)amino]ethyl]octanimidate (PubChem CID 101286143) has the molecular formula C17H33N2NaO4 and a molecular weight of 352.45 g/mol. Its IUPAC name is sodium N-[2-[2-carboxyethyl(4-hydroxybutyl)amino]ethyl]octanimidate.
| Compound Name | sodium N-[2-[2-carboxyethyl(4-hydroxybutyl)amino]ethyl]octanimidate |
|---|---|
| PubChem CID | 101286143 |
| Molecular Formula | C17H33N2NaO4 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | sodium N-[2-[2-carboxyethyl(4-hydroxybutyl)amino]ethyl]octanimidate |
| SMILES | CCCCCCC/C([O-])=N/CCN(CCCCO)CCC(=O)O.[Na+] |
| InChI | InChI=1S/C17H34N2O4.Na/c1-2-3-4-5-6-9-16(21)18-11-14-19(12-7-8-15-20)13-10-17(22)23;/h20H,2-15H2,1H3,(H,18,21)(H,22,23);/q;+1/p-1 |
| InChIKey | VEMBNIUGTKKJFU-UHFFFAOYSA-M |
| XLogP | -1.34 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|