About 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid
2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid (PubChem CID 90146098) has the molecular formula C39H81NO4
and a molecular weight of 628.08 g/mol. Its IUPAC name is 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid.
Molecular Properties
| Compound Name | 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid |
| PubChem CID | 90146098 |
| Molecular Formula | C39H81NO4 |
| Molecular Weight | 628.08 g/mol |
| Exact Mass | 627.62 |
| IUPAC Name | 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCCCN(CCO)CCO |
| InChI | InChI=1S/C21H45NO2.C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(18-20-23)19-21-24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h23-24H,2-21H2,1H3;2-17H2,1H3,(H,19,20) |
| InChIKey | CJBGGNFMTDQFOK-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.08 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid?
The IUPAC name of 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid (CID 90146098) is 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid.
What is the SMILES notation for 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid?
The canonical SMILES for 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCCCN(CCO)CCO.
What is the InChIKey of 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid?
The InChIKey is CJBGGNFMTDQFOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45NO2.C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(18-20-23)19-21-24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h23-24H,2-21H2,1H3;2-17H2,1H3,(H,19,20).
What are the key properties of 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid?
2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid has a molecular weight of 628.08 g/mol, XLogP of 11.48, 36 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[heptadecyl(2-hydroxyethyl)amino]ethanol;octadecanoic acid is sourced from PubChem (CID 90146098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).