About docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol
docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol (PubChem CID 158369485) has the molecular formula C40H83NO4
and a molecular weight of 642.11 g/mol. Its IUPAC name is docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol.
Molecular Properties
| Compound Name | docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol |
| PubChem CID | 158369485 |
| Molecular Formula | C40H83NO4 |
| Molecular Weight | 642.11 g/mol |
| Exact Mass | 641.63 |
| IUPAC Name | docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCN(CCO)CCO |
| InChI | InChI=1S/C22H44O2.C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-19(15-17-20)16-18-21/h2-21H2,1H3,(H,23,24);20-21H,2-18H2,1H3 |
| InChIKey | GULAMMNCHVIZBS-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.11 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol?
The IUPAC name of docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol (CID 158369485) is docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol.
What is the SMILES notation for docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol?
The canonical SMILES for docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol is CCCCCCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCN(CCO)CCO.
What is the InChIKey of docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol?
The InChIKey is GULAMMNCHVIZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2.C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-19(15-17-20)16-18-21/h2-21H2,1H3,(H,23,24);20-21H,2-18H2,1H3.
What are the key properties of docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol?
docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol has a molecular weight of 642.11 g/mol, XLogP of 11.87, 37 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for docosanoic acid;2-[2-hydroxyethyl(tetradecyl)amino]ethanol is sourced from PubChem (CID 158369485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).