C14H25KN2O4 — CID 101286166
potassium (E)-N-[[carboxymethyl(3-hydroxypropyl)amino]methyl]oct-6-enimidate (PubChem CID 101286166) has the molecular formula C14H25KN2O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is potassium (E)-N-[[carboxymethyl(3-hydroxypropyl)amino]methyl]oct-6-enimidate.
| Compound Name | potassium (E)-N-[[carboxymethyl(3-hydroxypropyl)amino]methyl]oct-6-enimidate |
|---|---|
| PubChem CID | 101286166 |
| Molecular Formula | C14H25KN2O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | potassium (E)-N-[[carboxymethyl(3-hydroxypropyl)amino]methyl]oct-6-enimidate |
| SMILES | C/C=C/CCCCC([O-])=NCN(CCCO)CC(=O)O.[K+] |
| InChI | InChI=1S/C14H26N2O4.K/c1-2-3-4-5-6-8-13(18)15-12-16(9-7-10-17)11-14(19)20;/h2-3,17H,4-12H2,1H3,(H,15,18)(H,19,20);/q;+1/p-1/b3-2+; |
| InChIKey | RNXAAKMIOCHOGU-SQQVDAMQSA-M |
| XLogP | -2.39 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|