C16H29LiN2O4 — CID 101286542
lithium (E)-N-[2-[1-carboxyethyl(2-hydroxypropyl)amino]ethyl]oct-6-enimidate (PubChem CID 101286542) has the molecular formula C16H29LiN2O4 and a molecular weight of 320.36 g/mol. Its IUPAC name is lithium (E)-N-[2-[1-carboxyethyl(2-hydroxypropyl)amino]ethyl]oct-6-enimidate.
| Compound Name | lithium (E)-N-[2-[1-carboxyethyl(2-hydroxypropyl)amino]ethyl]oct-6-enimidate |
|---|---|
| PubChem CID | 101286542 |
| Molecular Formula | C16H29LiN2O4 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | lithium (E)-N-[2-[1-carboxyethyl(2-hydroxypropyl)amino]ethyl]oct-6-enimidate |
| SMILES | C/C=C/CCCC/C([O-])=N/CCN(CC(C)O)C(C)C(=O)O.[Li+] |
| InChI | InChI=1S/C16H30N2O4.Li/c1-4-5-6-7-8-9-15(20)17-10-11-18(12-13(2)19)14(3)16(21)22;/h4-5,13-14,19H,6-12H2,1-3H3,(H,17,20)(H,21,22);/q;+1/p-1/b5-4+; |
| InChIKey | MNSYUOULLQGOTQ-FXRZFVDSSA-M |
| XLogP | -1.96 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|