C15H27N2NaO4 — CID 101286350
sodium N-[[1-carboxyethyl(2-hydroxypropyl)amino]methyl]oct-7-enimidate (PubChem CID 101286350) has the molecular formula C15H27N2NaO4 and a molecular weight of 322.38 g/mol. Its IUPAC name is sodium N-[[1-carboxyethyl(2-hydroxypropyl)amino]methyl]oct-7-enimidate.
| Compound Name | sodium N-[[1-carboxyethyl(2-hydroxypropyl)amino]methyl]oct-7-enimidate |
|---|---|
| PubChem CID | 101286350 |
| Molecular Formula | C15H27N2NaO4 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | sodium N-[[1-carboxyethyl(2-hydroxypropyl)amino]methyl]oct-7-enimidate |
| SMILES | C=CCCCCCC([O-])=NCN(CC(C)O)C(C)C(=O)O.[Na+] |
| InChI | InChI=1S/C15H28N2O4.Na/c1-4-5-6-7-8-9-14(19)16-11-17(10-12(2)18)13(3)15(20)21;/h4,12-13,18H,1,5-11H2,2-3H3,(H,16,19)(H,20,21);/q;+1/p-1 |
| InChIKey | ZCJIWUSANRBUQF-UHFFFAOYSA-M |
| XLogP | -2.00 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|