C17H28Li2N2O7 — CID 101285108
dilithium;2-[2-[bis(1-carboxyethyl)amino]ethyl-[(Z)-2-oxidohex-1-enyl]amino]propanoate (PubChem CID 101285108) has the molecular formula C17H28Li2N2O7 and a molecular weight of 386.30 g/mol. Its IUPAC name is dilithium;2-[2-[bis(1-carboxyethyl)amino]ethyl-[(Z)-2-oxidohex-1-enyl]amino]propanoate.
| Compound Name | dilithium;2-[2-[bis(1-carboxyethyl)amino]ethyl-[(Z)-2-oxidohex-1-enyl]amino]propanoate |
|---|---|
| PubChem CID | 101285108 |
| Molecular Formula | C17H28Li2N2O7 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | dilithium;2-[2-[bis(1-carboxyethyl)amino]ethyl-[(Z)-2-oxidohex-1-enyl]amino]propanoate |
| SMILES | CCCC/C([O-])=C/N(CCN(C(C)C(=O)O)C(C)C(=O)O)C(C)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C17H30N2O7.2Li/c1-5-6-7-14(20)10-18(11(2)15(21)22)8-9-19(12(3)16(23)24)13(4)17(25)26;;/h10-13,20H,5-9H2,1-4H3,(H,21,22)(H,23,24)(H,25,26);;/q;2*+1/p-2/b14-10-;; |
| InChIKey | CCWLDRARASLTLX-UFMFWQRBSA-L |
| XLogP | -6.93 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | -6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|