C7H8NO7-3 — CID 144600061
2-(1-carboxylatoethylamino)-3-hydroxybutanedioate (PubChem CID 144600061) has the molecular formula C7H8NO7-3 and a molecular weight of 218.14 g/mol. Its IUPAC name is 2-(1-carboxylatoethylamino)-3-hydroxybutanedioate.
| Compound Name | 2-(1-carboxylatoethylamino)-3-hydroxybutanedioate |
|---|---|
| PubChem CID | 144600061 |
| Molecular Formula | C7H8NO7-3 |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-(1-carboxylatoethylamino)-3-hydroxybutanedioate |
| SMILES | CC(NC(C(=O)[O-])C(O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H11NO7/c1-2(5(10)11)8-3(6(12)13)4(9)7(14)15/h2-4,8-9H,1H3,(H,10,11)(H,12,13)(H,14,15)/p-3 |
| InChIKey | AVSVNWVIMQANKV-UHFFFAOYSA-K |
| XLogP | -6.06 |
| TPSA | 152.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | -6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |