C4H12CuO10 — CID 159915205
copper;2,3-dihydroxybutanedioate;tetrahydrate (PubChem CID 159915205) has the molecular formula C4H12CuO10 and a molecular weight of 283.68 g/mol. Its IUPAC name is copper;2,3-dihydroxybutanedioate;tetrahydrate.
| Compound Name | copper;2,3-dihydroxybutanedioate;tetrahydrate |
|---|---|
| PubChem CID | 159915205 |
| Molecular Formula | C4H12CuO10 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | copper;2,3-dihydroxybutanedioate;tetrahydrate |
| SMILES | O.O.O.O.O=C([O-])C(O)C(O)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/C4H6O6.Cu.4H2O/c5-1(3(7)8)2(6)4(9)10;;;;;/h1-2,5-6H,(H,7,8)(H,9,10);;4*1H2/q;+2;;;;/p-2 |
| InChIKey | NXRPCZPHMICAKB-UHFFFAOYSA-L |
| XLogP | -8.09 |
| TPSA | 246.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | -8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |