C4H8FeNO6+2 — CID 22027283
azanium;2,3-dihydroxybutanedioate;iron(3+) (PubChem CID 22027283) has the molecular formula C4H8FeNO6+2 and a molecular weight of 221.95 g/mol. Its IUPAC name is azanium;2,3-dihydroxybutanedioate;iron(3+).
| Compound Name | azanium;2,3-dihydroxybutanedioate;iron(3+) |
|---|---|
| PubChem CID | 22027283 |
| Molecular Formula | C4H8FeNO6+2 |
| Molecular Weight | 221.95 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | azanium;2,3-dihydroxybutanedioate;iron(3+) |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-].[Fe+3].[NH4+] |
| InChI | InChI=1S/C4H6O6.Fe.H3N/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H3/q;+3;/p-1 |
| InChIKey | ODUOISCAHQKPFA-UHFFFAOYSA-M |
| XLogP | -4.42 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.95 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|