C4H4MnO6 — CID 22027285
2,3-dihydroxybutanedioate;manganese(2+) (PubChem CID 22027285) has the molecular formula C4H4MnO6 and a molecular weight of 203.01 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioate;manganese(2+).
| Compound Name | 2,3-dihydroxybutanedioate;manganese(2+) |
|---|---|
| PubChem CID | 22027285 |
| Molecular Formula | C4H4MnO6 |
| Molecular Weight | 203.01 g/mol |
| Exact Mass | 202.94 |
| IUPAC Name | 2,3-dihydroxybutanedioate;manganese(2+) |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-].[Mn+2] |
| InChI | InChI=1S/C4H6O6.Mn/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | LAYZVIPDEOEIDY-UHFFFAOYSA-L |
| XLogP | -4.79 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.01 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |