C4H4NaNiO6+ — CID 159221608
sodium;2,3-dihydroxybutanedioate;nickel(2+) (PubChem CID 159221608) has the molecular formula C4H4NaNiO6+ and a molecular weight of 229.75 g/mol. Its IUPAC name is sodium;2,3-dihydroxybutanedioate;nickel(2+).
| Compound Name | sodium;2,3-dihydroxybutanedioate;nickel(2+) |
|---|---|
| PubChem CID | 159221608 |
| Molecular Formula | C4H4NaNiO6+ |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 228.93 |
| IUPAC Name | sodium;2,3-dihydroxybutanedioate;nickel(2+) |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-].[Na+].[Ni+2] |
| InChI | InChI=1S/C4H6O6.Na.Ni/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;+1;+2/p-2 |
| InChIKey | KRTKVXWVZJEQKI-UHFFFAOYSA-L |
| XLogP | -7.79 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | -7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |