C4H4KNa2O6 — CID 86636910
CID 86636910 (PubChem CID 86636910) has the molecular formula C4H4KNa2O6 and a molecular weight of 233.15 g/mol.
| Compound Name | CID 86636910 |
|---|---|
| PubChem CID | 86636910 |
| Molecular Formula | C4H4KNa2O6 |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 232.94 |
| IUPAC Name | — |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-].[K].[Na+].[Na+] |
| InChI | InChI=1S/C4H6O6.K.2Na/c5-1(3(7)8)2(6)4(9)10;;;/h1-2,5-6H,(H,7,8)(H,9,10);;;/q;;2*+1/p-2 |
| InChIKey | BCAOGOBUDQOBFL-UHFFFAOYSA-L |
| XLogP | -11.16 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | -11.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |