C5H6CaO9 — CID 158616443
calcium;carbonic acid;2,3-dihydroxybutanedioate (PubChem CID 158616443) has the molecular formula C5H6CaO9 and a molecular weight of 250.17 g/mol. Its IUPAC name is calcium;carbonic acid;2,3-dihydroxybutanedioate.
| Compound Name | calcium;carbonic acid;2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 158616443 |
| Molecular Formula | C5H6CaO9 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | calcium;carbonic acid;2,3-dihydroxybutanedioate |
| SMILES | O=C(O)O.O=C([O-])C(O)C(O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C4H6O6.CH2O3.Ca/c5-1(3(7)8)2(6)4(9)10;2-1(3)4;/h1-2,5-6H,(H,7,8)(H,9,10);(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | HXLIPDPINRYGJF-UHFFFAOYSA-L |
| XLogP | -4.95 |
| TPSA | 178.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |