C4H6CaO7 — CID 161409159
calcium;2,3-dihydroxybutanedioate;hydrate (PubChem CID 161409159) has the molecular formula C4H6CaO7 and a molecular weight of 206.16 g/mol. Its IUPAC name is calcium;2,3-dihydroxybutanedioate;hydrate.
| Compound Name | calcium;2,3-dihydroxybutanedioate;hydrate |
|---|---|
| PubChem CID | 161409159 |
| Molecular Formula | C4H6CaO7 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 205.97 |
| IUPAC Name | calcium;2,3-dihydroxybutanedioate;hydrate |
| SMILES | O.O=C([O-])C(O)C(O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C4H6O6.Ca.H2O/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H2/q;+2;/p-2 |
| InChIKey | VVFXBLDLGDHAHR-UHFFFAOYSA-L |
| XLogP | -6.00 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | -6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |