C4H6CuO7- — CID 22034457
copper(1+);2,3-dihydroxybutanedioate;hydrate (PubChem CID 22034457) has the molecular formula C4H6CuO7- and a molecular weight of 229.63 g/mol. Its IUPAC name is copper(1+);2,3-dihydroxybutanedioate;hydrate.
| Compound Name | copper(1+);2,3-dihydroxybutanedioate;hydrate |
|---|---|
| PubChem CID | 22034457 |
| Molecular Formula | C4H6CuO7- |
| Molecular Weight | 229.63 g/mol |
| Exact Mass | 228.94 |
| IUPAC Name | copper(1+);2,3-dihydroxybutanedioate;hydrate |
| SMILES | O.O=C([O-])C(O)C(O)C(=O)[O-].[Cu+] |
| InChI | InChI=1S/C4H6O6.Cu.H2O/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H2/q;+1;/p-2 |
| InChIKey | MFGDMKUBBCPNPW-UHFFFAOYSA-L |
| XLogP | -5.62 |
| TPSA | 152.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.63 |
| LogP ≤ 5 | -5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |