C4H4K2O6 — CID 6452017
dipotassium;(2R,3S)-2,3-dihydroxybutanedioate (PubChem CID 6452017) has the molecular formula C4H4K2O6 and a molecular weight of 226.27 g/mol. Its IUPAC name is dipotassium;(2R,3S)-2,3-dihydroxybutanedioate.
| Compound Name | dipotassium;(2R,3S)-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 6452017 |
| Molecular Formula | C4H4K2O6 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 225.93 |
| IUPAC Name | dipotassium;(2R,3S)-2,3-dihydroxybutanedioate |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2+;; |
| InChIKey | AVTYONGGKAJVTE-BZMHZNRSSA-L |
| XLogP | -10.78 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | -10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |