C4H4KO6Zr+ — CID 19373860
potassium;2,3-dihydroxybutanedioate;zirconium(2+) (PubChem CID 19373860) has the molecular formula C4H4KO6Zr+ and a molecular weight of 278.39 g/mol. Its IUPAC name is potassium;2,3-dihydroxybutanedioate;zirconium(2+).
| Compound Name | potassium;2,3-dihydroxybutanedioate;zirconium(2+) |
|---|---|
| PubChem CID | 19373860 |
| Molecular Formula | C4H4KO6Zr+ |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 276.87 |
| IUPAC Name | potassium;2,3-dihydroxybutanedioate;zirconium(2+) |
| SMILES | O=C([O-])C(O)C(O)C(=O)[O-].[K+].[Zr+2] |
| InChI | InChI=1S/C4H6O6.K.Zr/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;+1;+2/p-2 |
| InChIKey | URMQXLWOEVCIPA-UHFFFAOYSA-L |
| XLogP | -7.79 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | -7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |