C5H8NO3- — CID 6926438
(2S)-2-acetamidopropanoate (PubChem CID 6926438) has the molecular formula C5H8NO3- and a molecular weight of 130.12 g/mol. Its IUPAC name is (2S)-2-acetamidopropanoate.
| Compound Name | (2S)-2-acetamidopropanoate |
|---|---|
| PubChem CID | 6926438 |
| Molecular Formula | C5H8NO3- |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | (2S)-2-acetamidopropanoate |
| SMILES | CC(=O)N[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C5H9NO3/c1-3(5(8)9)6-4(2)7/h3H,1-2H3,(H,6,7)(H,8,9)/p-1/t3-/m0/s1 |
| InChIKey | KTHDTJVBEPMMGL-VKHMYHEASA-M |
| XLogP | -1.74 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |