About (2S)-2-acetamidopropanoate;copper(1+)
(2S)-2-acetamidopropanoate;copper(1+) (PubChem CID 175469092) has the molecular formula C5H8CuNO3
and a molecular weight of 193.67 g/mol. Its IUPAC name is (2S)-2-acetamidopropanoate;copper(1+).
Molecular Properties
| Compound Name | (2S)-2-acetamidopropanoate;copper(1+) |
| PubChem CID | 175469092 |
| Molecular Formula | C5H8CuNO3 |
| Molecular Weight | 193.67 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | (2S)-2-acetamidopropanoate;copper(1+) |
| SMILES | CC(=O)N[C@@H](C)C(=O)[O-].[Cu+] |
| InChI | InChI=1S/C5H9NO3.Cu/c1-3(5(8)9)6-4(2)7;/h3H,1-2H3,(H,6,7)(H,8,9);/q;+1/p-1/t3-;/m0./s1 |
| InChIKey | QJIAQBWLUUGBLU-DFWYDOINSA-M |
| XLogP | -1.74 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.67 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-acetamidopropanoate;copper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-acetamidopropanoate;copper(1+)?
The IUPAC name of (2S)-2-acetamidopropanoate;copper(1+) (CID 175469092) is (2S)-2-acetamidopropanoate;copper(1+).
What is the SMILES notation for (2S)-2-acetamidopropanoate;copper(1+)?
The canonical SMILES for (2S)-2-acetamidopropanoate;copper(1+) is CC(=O)N[C@@H](C)C(=O)[O-].[Cu+].
What is the InChIKey of (2S)-2-acetamidopropanoate;copper(1+)?
The InChIKey is QJIAQBWLUUGBLU-DFWYDOINSA-M. The full InChI is InChI=1S/C5H9NO3.Cu/c1-3(5(8)9)6-4(2)7;/h3H,1-2H3,(H,6,7)(H,8,9);/q;+1/p-1/t3-;/m0./s1.
What are the key properties of (2S)-2-acetamidopropanoate;copper(1+)?
(2S)-2-acetamidopropanoate;copper(1+) has a molecular weight of 193.67 g/mol, XLogP of -1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-acetamidopropanoate;copper(1+) is sourced from PubChem (CID 175469092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).