C10H24N2O6 — CID 139301413
2,3-dihydroxybutanedioate;bis(propan-2-ylazanium) (PubChem CID 139301413) has the molecular formula C10H24N2O6 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioate;bis(propan-2-ylazanium).
| Compound Name | 2,3-dihydroxybutanedioate;bis(propan-2-ylazanium) |
|---|---|
| PubChem CID | 139301413 |
| Molecular Formula | C10H24N2O6 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2,3-dihydroxybutanedioate;bis(propan-2-ylazanium) |
| SMILES | CC(C)[NH3+].CC(C)[NH3+].O=C([O-])C(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C4H6O6.2C3H9N/c5-1(3(7)8)2(6)4(9)10;2*1-3(2)4/h1-2,5-6H,(H,7,8)(H,9,10);2*3H,4H2,1-2H3 |
| InChIKey | MOUOCMSNPLHGRA-UHFFFAOYSA-N |
| XLogP | -5.52 |
| TPSA | 176.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |