C5H11NO6 — CID 139045346
methylazanium;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate (PubChem CID 139045346) has the molecular formula C5H11NO6 and a molecular weight of 181.14 g/mol. Its IUPAC name is methylazanium;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate.
| Compound Name | methylazanium;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 139045346 |
| Molecular Formula | C5H11NO6 |
| Molecular Weight | 181.14 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | methylazanium;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate |
| SMILES | C[NH3+].O=C([O-])[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C4H6O6.CH5N/c5-1(3(7)8)2(6)4(9)10;1-2/h1-2,5-6H,(H,7,8)(H,9,10);2H2,1H3/t1-,2-;/m1./s1 |
| InChIKey | DULPRFBKVYBMDM-ZVGUSBNCSA-N |
| XLogP | -4.60 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.14 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |