C4H8KNO6 — CID 102600774
potassium;azane;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate (PubChem CID 102600774) has the molecular formula C4H8KNO6 and a molecular weight of 205.21 g/mol. Its IUPAC name is potassium;azane;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate.
| Compound Name | potassium;azane;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 102600774 |
| Molecular Formula | C4H8KNO6 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | potassium;azane;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate |
| SMILES | N.O=C([O-])[C@H](O)[C@@H](O)C(=O)O.[K+] |
| InChI | InChI=1S/C4H6O6.K.H3N/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H3/q;+1;/p-1/t1-,2-;;/m1../s1 |
| InChIKey | SOJZPUFVOCGQIP-OLXYHTOASA-M |
| XLogP | -6.29 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |