C4H5O7Sb- — CID 6378487
CID 6378487 (PubChem CID 6378487) has the molecular formula C4H5O7Sb- and a molecular weight of 286.84 g/mol.
| Compound Name | CID 6378487 |
|---|---|
| PubChem CID | 6378487 |
| Molecular Formula | C4H5O7Sb- |
| Molecular Weight | 286.84 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | — |
| SMILES | O=C([O-])C(O)C(O)C(=O)O.O=[Sb] |
| InChI | InChI=1S/C4H6O6.O.Sb/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/p-1 |
| InChIKey | VFEKUDIBSLYDMH-UHFFFAOYSA-M |
| XLogP | -3.96 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.84 |
| LogP ≤ 5 | -3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|