C4H5O6- — CID 24755569
(2S,3R)-2,3,4-trihydroxy-4-oxobutanoate (PubChem CID 24755569) has the molecular formula C4H5O6- and a molecular weight of 149.08 g/mol. Its IUPAC name is (2S,3R)-2,3,4-trihydroxy-4-oxobutanoate.
| Compound Name | (2S,3R)-2,3,4-trihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 24755569 |
| Molecular Formula | C4H5O6- |
| Molecular Weight | 149.08 g/mol |
| Exact Mass | 149.01 |
| IUPAC Name | (2S,3R)-2,3,4-trihydroxy-4-oxobutanoate |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/p-1/t1-,2+ |
| InChIKey | FEWJPZIEWOKRBE-XIXRPRMCSA-M |
| XLogP | -3.46 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.08 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |