C6H9NaO8 — CID 89497134
sodium;2,3-dihydroxybutanedioic acid;acetate (PubChem CID 89497134) has the molecular formula C6H9NaO8 and a molecular weight of 232.12 g/mol. Its IUPAC name is sodium;2,3-dihydroxybutanedioic acid;acetate.
| Compound Name | sodium;2,3-dihydroxybutanedioic acid;acetate |
|---|---|
| PubChem CID | 89497134 |
| Molecular Formula | C6H9NaO8 |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | sodium;2,3-dihydroxybutanedioic acid;acetate |
| SMILES | CC(=O)[O-].O=C(O)C(O)C(O)C(=O)O.[Na+] |
| InChI | InChI=1S/C4H6O6.C2H4O2.Na/c5-1(3(7)8)2(6)4(9)10;1-2(3)4;/h1-2,5-6H,(H,7,8)(H,9,10);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | OHZIRJBLJOOICZ-UHFFFAOYSA-M |
| XLogP | -6.36 |
| TPSA | 155.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | -6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |