C8H8CaNNaO8 — CID 175697415
calcium;sodium;2-[(2-carboxy-1-carboxylatoethyl)amino]butanedioate (PubChem CID 175697415) has the molecular formula C8H8CaNNaO8 and a molecular weight of 309.22 g/mol. Its IUPAC name is calcium;sodium;2-[(2-carboxy-1-carboxylatoethyl)amino]butanedioate.
| Compound Name | calcium;sodium;2-[(2-carboxy-1-carboxylatoethyl)amino]butanedioate |
|---|---|
| PubChem CID | 175697415 |
| Molecular Formula | C8H8CaNNaO8 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | calcium;sodium;2-[(2-carboxy-1-carboxylatoethyl)amino]butanedioate |
| SMILES | O=C([O-])CC(NC(CC(=O)O)C(=O)[O-])C(=O)[O-].[Ca+2].[Na+] |
| InChI | InChI=1S/C8H11NO8.Ca.Na/c10-5(11)1-3(7(14)15)9-4(8(16)17)2-6(12)13;;/h3-4,9H,1-2H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17);;/q;+2;+1/p-3 |
| InChIKey | DYTAJSNYEQHECT-UHFFFAOYSA-K |
| XLogP | -8.95 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | -8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |