C5H6N2O5-2 — CID 5460257
(2S)-2-(carbamoylamino)butanedioate (PubChem CID 5460257) has the molecular formula C5H6N2O5-2 and a molecular weight of 174.11 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)butanedioate.
| Compound Name | (2S)-2-(carbamoylamino)butanedioate |
|---|---|
| PubChem CID | 5460257 |
| Molecular Formula | C5H6N2O5-2 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | (2S)-2-(carbamoylamino)butanedioate |
| SMILES | NC(=O)N[C@@H](CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H8N2O5/c6-5(12)7-2(4(10)11)1-3(8)9/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12)/p-2/t2-/m0/s1 |
| InChIKey | HLKXYZVTANABHZ-REOHCLBHSA-L |
| XLogP | -4.09 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |