C9H15N2O5- — CID 7009607
(2S)-2-[[(2S)-2-azaniumyl-3-methylbutanoyl]amino]butanedioate (PubChem CID 7009607) has the molecular formula C9H15N2O5- and a molecular weight of 231.23 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-azaniumyl-3-methylbutanoyl]amino]butanedioate.
| Compound Name | (2S)-2-[[(2S)-2-azaniumyl-3-methylbutanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 7009607 |
| Molecular Formula | C9H15N2O5- |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (2S)-2-[[(2S)-2-azaniumyl-3-methylbutanoyl]amino]butanedioate |
| SMILES | CC(C)[C@H]([NH3+])C(=O)N[C@@H](CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H16N2O5/c1-4(2)7(10)8(14)11-5(9(15)16)3-6(12)13/h4-5,7H,3,10H2,1-2H3,(H,11,14)(H,12,13)(H,15,16)/p-1/t5-,7-/m0/s1 |
| InChIKey | OBTCMSPFOITUIJ-FSPLSTOPSA-M |
| XLogP | -4.37 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |