C10H19N5O5 — CID 7009611
(2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]butanedioate (PubChem CID 7009611) has the molecular formula C10H19N5O5 and a molecular weight of 289.29 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]butanedioate.
| Compound Name | (2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 7009611 |
| Molecular Formula | C10H19N5O5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]butanedioate |
| SMILES | NC(N)=[NH+]CCC[C@H]([NH3+])C(=O)N[C@@H](CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H19N5O5/c11-5(2-1-3-14-10(12)13)8(18)15-6(9(19)20)4-7(16)17/h5-6H,1-4,11H2,(H,15,18)(H,16,17)(H,19,20)(H4,12,13,14)/t5-,6-/m0/s1 |
| InChIKey | SIFXMYAHXJGAFC-WDSKDSINSA-N |
| XLogP | -7.89 |
| TPSA | 203.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -7.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|