C12H28N8O4 — CID 139182397
(2S)-2-amino-5-(diaminomethylideneazaniumyl)pentanoate (PubChem CID 139182397) has the molecular formula C12H28N8O4 and a molecular weight of 348.41 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneazaniumyl)pentanoate.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneazaniumyl)pentanoate |
|---|---|
| PubChem CID | 139182397 |
| Molecular Formula | C12H28N8O4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneazaniumyl)pentanoate |
| SMILES | NC(N)=[NH+]CCC[C@H](N)C(=O)[O-].NC(N)=[NH+]CCC[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/2C6H14N4O2/c2*7-4(5(11)12)2-1-3-10-6(8)9/h2*4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t2*4-/m00/s1 |
| InChIKey | OIXLLKLZKCBCPS-RZVRUWJTSA-N |
| XLogP | -9.60 |
| TPSA | 264.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | -9.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|