C10H23N4O+ — CID 149017297
(4-amino-6-methyl-5-oxooctyl)-(diaminomethylidene)azanium (PubChem CID 149017297) has the molecular formula C10H23N4O+ and a molecular weight of 215.32 g/mol. Its IUPAC name is (4-amino-6-methyl-5-oxooctyl)-(diaminomethylidene)azanium.
| Compound Name | (4-amino-6-methyl-5-oxooctyl)-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 149017297 |
| Molecular Formula | C10H23N4O+ |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (4-amino-6-methyl-5-oxooctyl)-(diaminomethylidene)azanium |
| SMILES | CCC(C)C(=O)C(N)CCC[NH+]=C(N)N |
| InChI | InChI=1S/C10H22N4O/c1-3-7(2)9(15)8(11)5-4-6-14-10(12)13/h7-8H,3-6,11H2,1-2H3,(H4,12,13,14)/p+1 |
| InChIKey | QCUGVWGFWWNRJE-UHFFFAOYSA-O |
| XLogP | -1.94 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|