C18H36N2O2 — CID 91001837
5-amino-9,10-diethyl-3,10-dimethyl-4-oxododecanamide (PubChem CID 91001837) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 5-amino-9,10-diethyl-3,10-dimethyl-4-oxododecanamide.
| Compound Name | 5-amino-9,10-diethyl-3,10-dimethyl-4-oxododecanamide |
|---|---|
| PubChem CID | 91001837 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 5-amino-9,10-diethyl-3,10-dimethyl-4-oxododecanamide |
| SMILES | CCC(CCCC(N)C(=O)C(C)CC(N)=O)C(C)(CC)CC |
| InChI | InChI=1S/C18H36N2O2/c1-6-14(18(5,7-2)8-3)10-9-11-15(19)17(22)13(4)12-16(20)21/h13-15H,6-12,19H2,1-5H3,(H2,20,21) |
| InChIKey | TZQVZEWHGNUKMG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |