C15H31NO — CID 163517546
(9S)-3-amino-7-ethyl-7,9-dimethylundecan-2-one (PubChem CID 163517546) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is (9S)-3-amino-7-ethyl-7,9-dimethylundecan-2-one.
| Compound Name | (9S)-3-amino-7-ethyl-7,9-dimethylundecan-2-one |
|---|---|
| PubChem CID | 163517546 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | (9S)-3-amino-7-ethyl-7,9-dimethylundecan-2-one |
| SMILES | CC[C@H](C)CC(C)(CC)CCCC(N)C(C)=O |
| InChI | InChI=1S/C15H31NO/c1-6-12(3)11-15(5,7-2)10-8-9-14(16)13(4)17/h12,14H,6-11,16H2,1-5H3/t12-,14?,15?/m0/s1 |
| InChIKey | DIANJPCDKLQNAY-GRTSSRMGSA-N |
| XLogP | 3.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |