C17H38 — CID 143713458
ethene;(3S)-5-ethyl-3,5-dimethyloctane;propane (PubChem CID 143713458) has the molecular formula C17H38 and a molecular weight of 242.49 g/mol. Its IUPAC name is ethene;(3S)-5-ethyl-3,5-dimethyloctane;propane.
| Compound Name | ethene;(3S)-5-ethyl-3,5-dimethyloctane;propane |
|---|---|
| PubChem CID | 143713458 |
| Molecular Formula | C17H38 |
| Molecular Weight | 242.49 g/mol |
| Exact Mass | 242.30 |
| IUPAC Name | ethene;(3S)-5-ethyl-3,5-dimethyloctane;propane |
| SMILES | C=C.CCC.CCCC(C)(CC)C[C@@H](C)CC |
| InChI | InChI=1S/C12H26.C3H8.C2H4/c1-6-9-12(5,8-3)10-11(4)7-2;1-3-2;1-2/h11H,6-10H2,1-5H3;3H2,1-2H3;1-2H2/t11-,12?;;/m0../s1 |
| InChIKey | JMJPOCYLOUAQKB-VWTXCZJDSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.49 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|