C16H34 — CID 58193630
(4R,6S)-2,2,4,6-tetramethyl-4-propylnonane (PubChem CID 58193630) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is (4R,6S)-2,2,4,6-tetramethyl-4-propylnonane.
| Compound Name | (4R,6S)-2,2,4,6-tetramethyl-4-propylnonane |
|---|---|
| PubChem CID | 58193630 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | (4R,6S)-2,2,4,6-tetramethyl-4-propylnonane |
| SMILES | CCC[C@H](C)C[C@@](C)(CCC)CC(C)(C)C |
| InChI | InChI=1S/C16H34/c1-8-10-14(3)12-16(7,11-9-2)13-15(4,5)6/h14H,8-13H2,1-7H3/t14-,16+/m0/s1 |
| InChIKey | STJZQPCEFXVRLJ-GOEBONIOSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |