C14H31N — CID 43731065
2,4,4-trimethyl-N-(2-methylpentyl)pentan-2-amine (PubChem CID 43731065) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-(2-methylpentyl)pentan-2-amine.
| Compound Name | 2,4,4-trimethyl-N-(2-methylpentyl)pentan-2-amine |
|---|---|
| PubChem CID | 43731065 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 2,4,4-trimethyl-N-(2-methylpentyl)pentan-2-amine |
| SMILES | CCCC(C)CNC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H31N/c1-8-9-12(2)10-15-14(6,7)11-13(3,4)5/h12,15H,8-11H2,1-7H3 |
| InChIKey | JIOAFRZKTOSQPG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |