C17H37N — CID 4618605
N-(2,4,4-trimethylpentan-2-yl)nonan-1-amine (PubChem CID 4618605) has the molecular formula C17H37N and a molecular weight of 255.49 g/mol. Its IUPAC name is N-(2,4,4-trimethylpentan-2-yl)nonan-1-amine.
| Compound Name | N-(2,4,4-trimethylpentan-2-yl)nonan-1-amine |
|---|---|
| PubChem CID | 4618605 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | N-(2,4,4-trimethylpentan-2-yl)nonan-1-amine |
| SMILES | CCCCCCCCCNC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H37N/c1-7-8-9-10-11-12-13-14-18-17(5,6)15-16(2,3)4/h18H,7-15H2,1-6H3 |
| InChIKey | MICUOSXOJDBBKA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|