C18H40N2O — CID 87347011
1,1-bis(octylamino)ethanol (PubChem CID 87347011) has the molecular formula C18H40N2O and a molecular weight of 300.53 g/mol. Its IUPAC name is 1,1-bis(octylamino)ethanol.
| Compound Name | 1,1-bis(octylamino)ethanol |
|---|---|
| PubChem CID | 87347011 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | 1,1-bis(octylamino)ethanol |
| SMILES | CCCCCCCCNC(C)(O)NCCCCCCCC |
| InChI | InChI=1S/C18H40N2O/c1-4-6-8-10-12-14-16-19-18(3,21)20-17-15-13-11-9-7-5-2/h19-21H,4-17H2,1-3H3 |
| InChIKey | XWGOBUNHPOULAR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|