C10H14F9N — CID 91419201
2-methyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pentan-1-amine (PubChem CID 91419201) has the molecular formula C10H14F9N and a molecular weight of 319.21 g/mol. Its IUPAC name is 2-methyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pentan-1-amine.
| Compound Name | 2-methyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pentan-1-amine |
|---|---|
| PubChem CID | 91419201 |
| Molecular Formula | C10H14F9N |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-methyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pentan-1-amine |
| SMILES | CCCC(C)CNC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F9N/c1-3-4-6(2)5-20-10(18,19)8(13,14)7(11,12)9(15,16)17/h6,20H,3-5H2,1-2H3 |
| InChIKey | IFLFTTXRPPDDSK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|