C11H14F11N — CID 90911133
4-methyl-N-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pentan-1-amine (PubChem CID 90911133) has the molecular formula C11H14F11N and a molecular weight of 369.22 g/mol. Its IUPAC name is 4-methyl-N-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pentan-1-amine.
| Compound Name | 4-methyl-N-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pentan-1-amine |
|---|---|
| PubChem CID | 90911133 |
| Molecular Formula | C11H14F11N |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-methyl-N-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pentan-1-amine |
| SMILES | CC(C)CCCNC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F11N/c1-6(2)4-3-5-23-11(21,22)9(16,17)7(12,13)8(14,15)10(18,19)20/h6,23H,3-5H2,1-2H3 |
| InChIKey | MZSCMKYXLYYWIA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|