C13H15F15N+ — CID 22348777
4-methylpentyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)azanium (PubChem CID 22348777) has the molecular formula C13H15F15N+ and a molecular weight of 470.24 g/mol. Its IUPAC name is 4-methylpentyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)azanium.
| Compound Name | 4-methylpentyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)azanium |
|---|---|
| PubChem CID | 22348777 |
| Molecular Formula | C13H15F15N+ |
| Molecular Weight | 470.24 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 4-methylpentyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)azanium |
| SMILES | CC(C)CCC[NH2+]C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F15N/c1-6(2)4-3-5-29-13(27,28)11(22,23)9(18,19)7(14,15)8(16,17)10(20,21)12(24,25)26/h6,29H,3-5H2,1-2H3/p+1 |
| InChIKey | BLYGTBIGWDOWBD-UHFFFAOYSA-O |
| XLogP | 5.32 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.24 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|