C9H19F3 — CID 157031744
2-methylhexane;1,1,1-trifluoroethane (PubChem CID 157031744) has the molecular formula C9H19F3 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-methylhexane;1,1,1-trifluoroethane.
| Compound Name | 2-methylhexane;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 157031744 |
| Molecular Formula | C9H19F3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 2-methylhexane;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CCCCC(C)C |
| InChI | InChI=1S/C7H16.C2H3F3/c1-4-5-6-7(2)3;1-2(3,4)5/h7H,4-6H2,1-3H3;1H3 |
| InChIKey | FZOMDMOICVKCAY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |