About 2,2-dimethylpropane;ethane;2-methylheptane
2,2-dimethylpropane;ethane;2-methylheptane (PubChem CID 143493212) has the molecular formula C19H48
and a molecular weight of 276.59 g/mol. Its IUPAC name is 2,2-dimethylpropane;ethane;2-methylheptane.
Molecular Properties
| Compound Name | 2,2-dimethylpropane;ethane;2-methylheptane |
| PubChem CID | 143493212 |
| Molecular Formula | C19H48 |
| Molecular Weight | 276.59 g/mol |
| Exact Mass | 276.38 |
| IUPAC Name | 2,2-dimethylpropane;ethane;2-methylheptane |
| SMILES | CC.CC.CC.CC(C)(C)C.CCCCCC(C)C |
| InChI | InChI=1S/C8H18.C5H12.3C2H6/c1-4-5-6-7-8(2)3;1-5(2,3)4;3*1-2/h8H,4-7H2,1-3H3;1-4H3;3*1-2H3 |
| InChIKey | QMBACIKGXQWOPJ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.59 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropane;ethane;2-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;ethane;2-methylheptane?
The IUPAC name of 2,2-dimethylpropane;ethane;2-methylheptane (CID 143493212) is 2,2-dimethylpropane;ethane;2-methylheptane.
What is the SMILES notation for 2,2-dimethylpropane;ethane;2-methylheptane?
The canonical SMILES for 2,2-dimethylpropane;ethane;2-methylheptane is CC.CC.CC.CC(C)(C)C.CCCCCC(C)C.
What is the InChIKey of 2,2-dimethylpropane;ethane;2-methylheptane?
The InChIKey is QMBACIKGXQWOPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C5H12.3C2H6/c1-4-5-6-7-8(2)3;1-5(2,3)4;3*1-2/h8H,4-7H2,1-3H3;1-4H3;3*1-2H3.
What are the key properties of 2,2-dimethylpropane;ethane;2-methylheptane?
2,2-dimethylpropane;ethane;2-methylheptane has a molecular weight of 276.59 g/mol, XLogP of 8.35, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;ethane;2-methylheptane is sourced from PubChem (CID 143493212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).