C25H15F39P+ — CID 10219307
methyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphanium (PubChem CID 10219307) has the molecular formula C25H15F39P+ and a molecular weight of 1087.29 g/mol. Its IUPAC name is methyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphanium.
| Compound Name | methyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphanium |
|---|---|
| PubChem CID | 10219307 |
| Molecular Formula | C25H15F39P+ |
| Molecular Weight | 1087.29 g/mol |
| Exact Mass | 1087.03 |
| IUPAC Name | methyl-tris(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phosphanium |
| SMILES | C[P+](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H15F39P/c1-65(5-2-8(26,27)11(32,33)14(38,39)17(44,45)20(50,51)23(56,57)58,6-3-9(28,29)12(34,35)15(40,41)18(46,47)21(52,53)24(59,60)61)7-4-10(30,31)13(36,37)16(42,43)19(48,49)22(54,55)25(62,63)64/h2-7H2,1H3/q+1 |
| InChIKey | BTECSBCNGTXIFC-UHFFFAOYSA-N |
| XLogP | 15.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.29 |
| LogP ≤ 5 | 15.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|